C13H16N3Y- — CID 176600378
1-methyl-N-(4-propan-2-ylbenzene-5-id-1-yl)pyrazol-3-amine;yttrium (PubChem CID 176600378) has the molecular formula C13H16N3Y- and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-methyl-N-(4-propan-2-ylbenzene-5-id-1-yl)pyrazol-3-amine;yttrium.
| Compound Name | 1-methyl-N-(4-propan-2-ylbenzene-5-id-1-yl)pyrazol-3-amine;yttrium |
|---|---|
| PubChem CID | 176600378 |
| Molecular Formula | C13H16N3Y- |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-methyl-N-(4-propan-2-ylbenzene-5-id-1-yl)pyrazol-3-amine;yttrium |
| SMILES | CC(C)c1[c-]cc(Nc2ccn(C)n2)cc1.[Y] |
| InChI | InChI=1S/C13H16N3.Y/c1-10(2)11-4-6-12(7-5-11)14-13-8-9-16(3)15-13;/h4,6-10H,1-3H3,(H,14,15);/q-1; |
| InChIKey | XZGYVMNVIYAINY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|