C19H29N5O2 — CID 176610112
N-[(1R)-1-(5-cyanopiperidin-2-yl)ethyl]-2-(4-methyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)acetamide (PubChem CID 176610112) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[(1R)-1-(5-cyanopiperidin-2-yl)ethyl]-2-(4-methyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)acetamide.
| Compound Name | N-[(1R)-1-(5-cyanopiperidin-2-yl)ethyl]-2-(4-methyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 176610112 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | N-[(1R)-1-(5-cyanopiperidin-2-yl)ethyl]-2-(4-methyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)acetamide |
| SMILES | CC1=C(CC(=O)N[C@H](C)C2CCC(C#N)CN2)C(=O)NC2CCNCC12 |
| InChI | InChI=1S/C19H29N5O2/c1-11-14(19(26)24-17-5-6-21-10-15(11)17)7-18(25)23-12(2)16-4-3-13(8-20)9-22-16/h12-13,15-17,21-22H,3-7,9-10H2,1-2H3,(H,23,25)(H,24,26)/t12-,13?,15?,16?,17?/m1/s1 |
| InChIKey | BIYASCUNSYMEMF-OBAOUDRSSA-N |
| XLogP | 0.20 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |