C21H28F6N2O2 — CID 176610237
N-[(1S)-1-(2,4-difluorocyclohexyl)ethyl]-2-[6-fluoro-4-methyl-2-oxo-5-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl]acetamide (PubChem CID 176610237) has the molecular formula C21H28F6N2O2 and a molecular weight of 454.46 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-difluorocyclohexyl)ethyl]-2-[6-fluoro-4-methyl-2-oxo-5-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl]acetamide.
| Compound Name | N-[(1S)-1-(2,4-difluorocyclohexyl)ethyl]-2-[6-fluoro-4-methyl-2-oxo-5-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl]acetamide |
|---|---|
| PubChem CID | 176610237 |
| Molecular Formula | C21H28F6N2O2 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | N-[(1S)-1-(2,4-difluorocyclohexyl)ethyl]-2-[6-fluoro-4-methyl-2-oxo-5-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl]acetamide |
| SMILES | CC1=C(CC(=O)N[C@@H](C)C2CCC(F)CC2F)C(=O)NC2CCC(F)C(C(F)(F)F)C12 |
| InChI | InChI=1S/C21H28F6N2O2/c1-9-13(8-17(30)28-10(2)12-4-3-11(22)7-15(12)24)20(31)29-16-6-5-14(23)19(18(9)16)21(25,26)27/h10-12,14-16,18-19H,3-8H2,1-2H3,(H,28,30)(H,29,31)/t10-,11?,12?,14?,15?,16?,18?,19?/m0/s1 |
| InChIKey | KOONAHOLCTZLRZ-APCMNOTQSA-N |
| XLogP | 4.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |