C22H28F2N4O2 — CID 176610147
N-[(1R)-1-(4-cyano-2-fluorocyclohexyl)ethyl]-2-(5-cyano-6-fluoro-4-methyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl)acetamide (PubChem CID 176610147) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[(1R)-1-(4-cyano-2-fluorocyclohexyl)ethyl]-2-(5-cyano-6-fluoro-4-methyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl)acetamide.
| Compound Name | N-[(1R)-1-(4-cyano-2-fluorocyclohexyl)ethyl]-2-(5-cyano-6-fluoro-4-methyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl)acetamide |
|---|---|
| PubChem CID | 176610147 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[(1R)-1-(4-cyano-2-fluorocyclohexyl)ethyl]-2-(5-cyano-6-fluoro-4-methyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl)acetamide |
| SMILES | CC1=C(CC(=O)N[C@H](C)C2CCC(C#N)CC2F)C(=O)NC2CCC(F)C(C#N)C12 |
| InChI | InChI=1S/C22H28F2N4O2/c1-11-15(22(30)28-19-6-5-17(23)16(10-26)21(11)19)8-20(29)27-12(2)14-4-3-13(9-25)7-18(14)24/h12-14,16-19,21H,3-8H2,1-2H3,(H,27,29)(H,28,30)/t12-,13?,14?,16?,17?,18?,19?,21?/m1/s1 |
| InChIKey | HXZFENXNOWYICB-BOEQCAAESA-N |
| XLogP | 2.86 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |