C20H29F3N2O2 — CID 176610163
(2S)-N-[(1S)-1-(2,4-difluorocyclohexyl)ethyl]-2-(5-fluoro-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl)propanamide (PubChem CID 176610163) has the molecular formula C20H29F3N2O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-(2,4-difluorocyclohexyl)ethyl]-2-(5-fluoro-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl)propanamide.
| Compound Name | (2S)-N-[(1S)-1-(2,4-difluorocyclohexyl)ethyl]-2-(5-fluoro-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 176610163 |
| Molecular Formula | C20H29F3N2O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (2S)-N-[(1S)-1-(2,4-difluorocyclohexyl)ethyl]-2-(5-fluoro-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-quinolin-3-yl)propanamide |
| SMILES | C[C@H](C(=O)N[C@@H](C)C1CCC(F)CC1F)C1=CC2C(F)CCCC2NC1=O |
| InChI | InChI=1S/C20H29F3N2O2/c1-10(14-9-15-16(22)4-3-5-18(15)25-20(14)27)19(26)24-11(2)13-7-6-12(21)8-17(13)23/h9-13,15-18H,3-8H2,1-2H3,(H,24,26)(H,25,27)/t10-,11-,12?,13?,15?,16?,17?,18?/m0/s1 |
| InChIKey | ONXSDIWLWYBSPV-KEZWHUNWSA-N |
| XLogP | 3.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |