C20H32N6O2 — CID 176610154
N-[(1S)-1-(2-cyano-4-methyl-1,3-diazinan-5-yl)ethyl]-2-(4,5-dimethyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)acetamide (PubChem CID 176610154) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is N-[(1S)-1-(2-cyano-4-methyl-1,3-diazinan-5-yl)ethyl]-2-(4,5-dimethyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)acetamide.
| Compound Name | N-[(1S)-1-(2-cyano-4-methyl-1,3-diazinan-5-yl)ethyl]-2-(4,5-dimethyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 176610154 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N-[(1S)-1-(2-cyano-4-methyl-1,3-diazinan-5-yl)ethyl]-2-(4,5-dimethyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)acetamide |
| SMILES | CC1=C(CC(=O)N[C@@H](C)C2CNC(C#N)NC2C)C(=O)NC2CCNC(C)C12 |
| InChI | InChI=1S/C20H32N6O2/c1-10-14(20(28)26-16-5-6-22-13(4)19(10)16)7-18(27)25-12(3)15-9-23-17(8-21)24-11(15)2/h11-13,15-17,19,22-24H,5-7,9H2,1-4H3,(H,25,27)(H,26,28)/t11?,12-,13?,15?,16?,17?,19?/m0/s1 |
| InChIKey | IMCCGFLVMQRPHH-FMGBLGCLSA-N |
| XLogP | -0.26 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |