C21H35N3O3 — CID 176610239
2-(4,5-dimethyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)-N-[(1R)-1-(4-methoxycyclohexyl)ethyl]acetamide (PubChem CID 176610239) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-(4,5-dimethyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)-N-[(1R)-1-(4-methoxycyclohexyl)ethyl]acetamide.
| Compound Name | 2-(4,5-dimethyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)-N-[(1R)-1-(4-methoxycyclohexyl)ethyl]acetamide |
|---|---|
| PubChem CID | 176610239 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 2-(4,5-dimethyl-2-oxo-4a,5,6,7,8,8a-hexahydro-1H-1,6-naphthyridin-3-yl)-N-[(1R)-1-(4-methoxycyclohexyl)ethyl]acetamide |
| SMILES | COC1CCC([C@@H](C)NC(=O)CC2=C(C)C3C(C)NCCC3NC2=O)CC1 |
| InChI | InChI=1S/C21H35N3O3/c1-12-17(21(26)24-18-9-10-22-14(3)20(12)18)11-19(25)23-13(2)15-5-7-16(27-4)8-6-15/h13-16,18,20,22H,5-11H2,1-4H3,(H,23,25)(H,24,26)/t13-,14?,15?,16?,18?,20?/m1/s1 |
| InChIKey | PECXBOOTDFIMJN-UPCFBVACSA-N |
| XLogP | 1.90 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |