C10H22NO2PS2 — CID 176611222
N-[2-[(2-methyl-4-phosphanyloxypentan-2-yl)disulfanyl]ethyl]acetamide (PubChem CID 176611222) has the molecular formula C10H22NO2PS2 and a molecular weight of 283.40 g/mol. Its IUPAC name is N-[2-[(2-methyl-4-phosphanyloxypentan-2-yl)disulfanyl]ethyl]acetamide.
| Compound Name | N-[2-[(2-methyl-4-phosphanyloxypentan-2-yl)disulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 176611222 |
| Molecular Formula | C10H22NO2PS2 |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-[2-[(2-methyl-4-phosphanyloxypentan-2-yl)disulfanyl]ethyl]acetamide |
| SMILES | CC(=O)NCCSSC(C)(C)CC(C)OP |
| InChI | InChI=1S/C10H22NO2PS2/c1-8(13-14)7-10(3,4)16-15-6-5-11-9(2)12/h8H,5-7,14H2,1-4H3,(H,11,12) |
| InChIKey | NRHVZBMIWMXREQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|