C14H13Cl2FN4O2 — CID 176612630
(9S)-14,18-dichloro-15-fluoro-7,11-dioxa-2,13,17,19-tetrazatetracyclo[10.7.1.02,9.016,20]icosa-1(19),12,14,16(20),17-pentaene (PubChem CID 176612630) has the molecular formula C14H13Cl2FN4O2 and a molecular weight of 359.19 g/mol. Its IUPAC name is (9S)-14,18-dichloro-15-fluoro-7,11-dioxa-2,13,17,19-tetrazatetracyclo[10.7.1.02,9.016,20]icosa-1(19),12,14,16(20),17-pentaene.
| Compound Name | (9S)-14,18-dichloro-15-fluoro-7,11-dioxa-2,13,17,19-tetrazatetracyclo[10.7.1.02,9.016,20]icosa-1(19),12,14,16(20),17-pentaene |
|---|---|
| PubChem CID | 176612630 |
| Molecular Formula | C14H13Cl2FN4O2 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (9S)-14,18-dichloro-15-fluoro-7,11-dioxa-2,13,17,19-tetrazatetracyclo[10.7.1.02,9.016,20]icosa-1(19),12,14,16(20),17-pentaene |
| SMILES | Fc1c(Cl)nc2c3c(nc(Cl)nc13)N1CCCCOC[C@H]1CO2 |
| InChI | InChI=1S/C14H13Cl2FN4O2/c15-11-9(17)10-8-12(20-14(16)18-10)21-3-1-2-4-22-5-7(21)6-23-13(8)19-11/h7H,1-6H2/t7-/m0/s1 |
| InChIKey | QTBBAAJACBANFE-ZETCQYMHSA-N |
| XLogP | 2.85 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|