C13H12ClFN4O2S — CID 176852172
(6R)-11-chloro-12-fluoro-15-methylsulfinyl-8-oxa-2,10,14,16-tetrazatetracyclo[7.7.1.02,6.013,17]heptadeca-1(16),9,11,13(17),14-pentaene (PubChem CID 176852172) has the molecular formula C13H12ClFN4O2S and a molecular weight of 342.78 g/mol. Its IUPAC name is (6R)-11-chloro-12-fluoro-15-methylsulfinyl-8-oxa-2,10,14,16-tetrazatetracyclo[7.7.1.02,6.013,17]heptadeca-1(16),9,11,13(17),14-pentaene.
| Compound Name | (6R)-11-chloro-12-fluoro-15-methylsulfinyl-8-oxa-2,10,14,16-tetrazatetracyclo[7.7.1.02,6.013,17]heptadeca-1(16),9,11,13(17),14-pentaene |
|---|---|
| PubChem CID | 176852172 |
| Molecular Formula | C13H12ClFN4O2S |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (6R)-11-chloro-12-fluoro-15-methylsulfinyl-8-oxa-2,10,14,16-tetrazatetracyclo[7.7.1.02,6.013,17]heptadeca-1(16),9,11,13(17),14-pentaene |
| SMILES | CS(=O)c1nc2c3c(nc(Cl)c(F)c3n1)OC[C@H]1CCCN21 |
| InChI | InChI=1S/C13H12ClFN4O2S/c1-22(20)13-16-9-7-11(18-13)19-4-2-3-6(19)5-21-12(7)17-10(14)8(9)15/h6H,2-5H2,1H3/t6-,22?/m1/s1 |
| InChIKey | CUTZZPUDHMFPFJ-PQKNKZFASA-N |
| XLogP | 1.92 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|