C15H16ClFN4O3S — CID 176612566
(8S)-13-chloro-14-fluoro-17-methylsulfonyl-10-oxa-2,12,16,18-tetrazatetracyclo[9.7.1.02,8.015,19]nonadeca-1(18),11,13,15(19),16-pentaene (PubChem CID 176612566) has the molecular formula C15H16ClFN4O3S and a molecular weight of 386.84 g/mol. Its IUPAC name is (8S)-13-chloro-14-fluoro-17-methylsulfonyl-10-oxa-2,12,16,18-tetrazatetracyclo[9.7.1.02,8.015,19]nonadeca-1(18),11,13,15(19),16-pentaene.
| Compound Name | (8S)-13-chloro-14-fluoro-17-methylsulfonyl-10-oxa-2,12,16,18-tetrazatetracyclo[9.7.1.02,8.015,19]nonadeca-1(18),11,13,15(19),16-pentaene |
|---|---|
| PubChem CID | 176612566 |
| Molecular Formula | C15H16ClFN4O3S |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (8S)-13-chloro-14-fluoro-17-methylsulfonyl-10-oxa-2,12,16,18-tetrazatetracyclo[9.7.1.02,8.015,19]nonadeca-1(18),11,13,15(19),16-pentaene |
| SMILES | CS(=O)(=O)c1nc2c3c(nc(Cl)c(F)c3n1)OC[C@@H]1CCCCCN21 |
| InChI | InChI=1S/C15H16ClFN4O3S/c1-25(22,23)15-18-11-9-13(20-15)21-6-4-2-3-5-8(21)7-24-14(9)19-12(16)10(11)17/h8H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | VYFPKLUBUGHWTR-QMMMGPOBSA-N |
| XLogP | 2.36 |
| TPSA | 85.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|