C47H30 — CID 176635167
21-[1,2,3,4,5,6,7,8-octadeuterio-10-(naphthalen-1-ylmethyl)anthracen-9-yl]pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene (PubChem CID 176635167) has the molecular formula C47H30 and a molecular weight of 602.81 g/mol. Its IUPAC name is 21-[1,2,3,4,5,6,7,8-octadeuterio-10-(naphthalen-1-ylmethyl)anthracen-9-yl]pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene.
| Compound Name | 21-[1,2,3,4,5,6,7,8-octadeuterio-10-(naphthalen-1-ylmethyl)anthracen-9-yl]pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 176635167 |
| Molecular Formula | C47H30 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 21-[1,2,3,4,5,6,7,8-octadeuterio-10-(naphthalen-1-ylmethyl)anthracen-9-yl]pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cc4c5ccccc5c5ccccc5c4c4ccccc34)c3c([2H])c([2H])c([2H])c([2H])c3c(Cc3cccc4ccccc34)c2c1[2H] |
| InChI | InChI=1S/C47H30/c1-2-17-32-30(14-1)15-13-16-31(32)28-43-36-21-6-10-25-40(36)47(41-26-11-7-22-37(41)43)45-29-44-35-20-4-3-18-33(35)34-19-5-9-24-39(34)46(44)42-27-12-8-23-38(42)45/h1-27,29H,28H2/i6D,7D,10D,11D,21D,22D,25D,26D |
| InChIKey | HLLOYDUWVIFIAA-ISIPLDFCSA-N |
| XLogP | 13.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|