C25H26NY — CID 176637647
3-(3-pentan-2-yl-4-propan-2-ylbenzene-2-id-1-yl)-2-phenylpyridine;yttrium(3+) (PubChem CID 176637647) has the molecular formula C25H26NY and a molecular weight of 429.40 g/mol. Its IUPAC name is 3-(3-pentan-2-yl-4-propan-2-ylbenzene-2-id-1-yl)-2-phenylpyridine;yttrium(3+).
| Compound Name | 3-(3-pentan-2-yl-4-propan-2-ylbenzene-2-id-1-yl)-2-phenylpyridine;yttrium(3+) |
|---|---|
| PubChem CID | 176637647 |
| Molecular Formula | C25H26NY |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 3-(3-pentan-2-yl-4-propan-2-ylbenzene-2-id-1-yl)-2-phenylpyridine;yttrium(3+) |
| SMILES | C[CH-]CC(C)c1[c-]c(-c2cccnc2-c2[c-]cccc2)ccc1C(C)C.[Y+3] |
| InChI | InChI=1S/C25H26N.Y/c1-5-10-19(4)24-17-21(14-15-22(24)18(2)3)23-13-9-16-26-25(23)20-11-7-6-8-12-20;/h5-9,11,13-16,18-19H,10H2,1-4H3;/q-3;+3 |
| InChIKey | JTTAAEFHDCDUQM-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|