C20H26O3 — CID 176639760
2-(4-methylpent-3-enyl)-7-pentyl-2H-chromene-5,8-dione (PubChem CID 176639760) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-(4-methylpent-3-enyl)-7-pentyl-2H-chromene-5,8-dione.
| Compound Name | 2-(4-methylpent-3-enyl)-7-pentyl-2H-chromene-5,8-dione |
|---|---|
| PubChem CID | 176639760 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 2-(4-methylpent-3-enyl)-7-pentyl-2H-chromene-5,8-dione |
| SMILES | CCCCCC1=CC(=O)C2=C(OC(CCC=C(C)C)C=C2)C1=O |
| InChI | InChI=1S/C20H26O3/c1-4-5-6-9-15-13-18(21)17-12-11-16(10-7-8-14(2)3)23-20(17)19(15)22/h8,11-13,16H,4-7,9-10H2,1-3H3 |
| InChIKey | LHMCDAHKDBQSJR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|