C24H13N5O2S — CID 176640732
(E)-3-[5-[5-[5-[(Z)-2-cyano-2-isocyanoethenyl]thieno[3,2-b]furan-2-yl]-1-ethylpyrrol-2-yl]furan-2-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 176640732) has the molecular formula C24H13N5O2S and a molecular weight of 435.47 g/mol. Its IUPAC name is (E)-3-[5-[5-[5-[(Z)-2-cyano-2-isocyanoethenyl]thieno[3,2-b]furan-2-yl]-1-ethylpyrrol-2-yl]furan-2-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (E)-3-[5-[5-[5-[(Z)-2-cyano-2-isocyanoethenyl]thieno[3,2-b]furan-2-yl]-1-ethylpyrrol-2-yl]furan-2-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 176640732 |
| Molecular Formula | C24H13N5O2S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (E)-3-[5-[5-[5-[(Z)-2-cyano-2-isocyanoethenyl]thieno[3,2-b]furan-2-yl]-1-ethylpyrrol-2-yl]furan-2-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1cc2oc(-c3ccc(-c4ccc(/C=C(\C#N)[N+]#[C-])o4)n3CC)cc2s1 |
| InChI | InChI=1S/C24H13N5O2S/c1-4-29-19(21-8-5-17(30-21)9-15(13-25)27-2)6-7-20(29)22-12-24-23(31-22)11-18(32-24)10-16(14-26)28-3/h5-12H,4H2,1H3/b15-9+,16-10- |
| InChIKey | ROSJGDGBHHNBCM-TYVLLQCESA-N |
| XLogP | 6.81 |
| TPSA | 87.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|