C27H14N6O2S — CID 171409055
3-[2-[5-[2-[5-[(E)-2-cyano-2-isocyanoethenyl]furan-2-yl]-1H-indol-6-yl]furan-2-yl]-1,3-thiazol-5-yl]-2-isocyanopropanenitrile (PubChem CID 171409055) has the molecular formula C27H14N6O2S and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-[2-[5-[2-[5-[(E)-2-cyano-2-isocyanoethenyl]furan-2-yl]-1H-indol-6-yl]furan-2-yl]-1,3-thiazol-5-yl]-2-isocyanopropanenitrile.
| Compound Name | 3-[2-[5-[2-[5-[(E)-2-cyano-2-isocyanoethenyl]furan-2-yl]-1H-indol-6-yl]furan-2-yl]-1,3-thiazol-5-yl]-2-isocyanopropanenitrile |
|---|---|
| PubChem CID | 171409055 |
| Molecular Formula | C27H14N6O2S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 3-[2-[5-[2-[5-[(E)-2-cyano-2-isocyanoethenyl]furan-2-yl]-1H-indol-6-yl]furan-2-yl]-1,3-thiazol-5-yl]-2-isocyanopropanenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C/c1ccc(-c2cc3ccc(-c4ccc(-c5ncc(CC(C#N)[N+]#[C-])s5)o4)cc3[nH]2)o1 |
| InChI | InChI=1S/C27H14N6O2S/c1-30-18(13-28)11-20-5-6-25(34-20)23-9-16-3-4-17(10-22(16)33-23)24-7-8-26(35-24)27-32-15-21(36-27)12-19(14-29)31-2/h3-11,15,19,33H,12H2/b18-11+ |
| InChIKey | OTINBGRUCSLZRZ-WOJGMQOQSA-N |
| XLogP | 6.95 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|