C20H17Cl2NO3 — CID 6293286
cyclohexyl (E)-2-cyano-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enoate (PubChem CID 6293286) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is cyclohexyl (E)-2-cyano-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enoate.
| Compound Name | cyclohexyl (E)-2-cyano-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 6293286 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | cyclohexyl (E)-2-cyano-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enoate |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C20H17Cl2NO3/c21-17-8-6-13(11-18(17)22)19-9-7-16(25-19)10-14(12-23)20(24)26-15-4-2-1-3-5-15/h6-11,15H,1-5H2/b14-10+ |
| InChIKey | AJXBRQYSBAUXNJ-GXDHUFHOSA-N |
| XLogP | 6.04 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|