C26H13N5O2 — CID 165376584
(2Z,4E)-5-[5-[2-[5-[(E)-2-cyano-2-isocyanoethenyl]furan-2-yl]-1H-indol-4-yl]furan-2-yl]-2-isocyanopenta-2,4-dienenitrile (PubChem CID 165376584) has the molecular formula C26H13N5O2 and a molecular weight of 427.42 g/mol. Its IUPAC name is (2Z,4E)-5-[5-[2-[5-[(E)-2-cyano-2-isocyanoethenyl]furan-2-yl]-1H-indol-4-yl]furan-2-yl]-2-isocyanopenta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-[5-[2-[5-[(E)-2-cyano-2-isocyanoethenyl]furan-2-yl]-1H-indol-4-yl]furan-2-yl]-2-isocyanopenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 165376584 |
| Molecular Formula | C26H13N5O2 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (2Z,4E)-5-[5-[2-[5-[(E)-2-cyano-2-isocyanoethenyl]furan-2-yl]-1H-indol-4-yl]furan-2-yl]-2-isocyanopenta-2,4-dienenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\C=C\c1ccc(-c2cccc3[nH]c(-c4ccc(/C=C(\C#N)[N+]#[C-])o4)cc23)o1 |
| InChI | InChI=1S/C26H13N5O2/c1-29-17(15-27)5-3-6-19-9-11-25(32-19)21-7-4-8-23-22(21)14-24(31-23)26-12-10-20(33-26)13-18(16-28)30-2/h3-14,31H/b6-3+,17-5-,18-13+ |
| InChIKey | SYBVUKWYGZMMAV-FQDZNYBUSA-N |
| XLogP | 6.81 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|