C13H21NO3Y-2 — CID 176646453
3-tert-butylpyrrolidin-1-ide-2,5-dione;2,2-dimethylpropan-1-one;yttrium (PubChem CID 176646453) has the molecular formula C13H21NO3Y-2 and a molecular weight of 328.22 g/mol. Its IUPAC name is 3-tert-butylpyrrolidin-1-ide-2,5-dione;2,2-dimethylpropan-1-one;yttrium.
| Compound Name | 3-tert-butylpyrrolidin-1-ide-2,5-dione;2,2-dimethylpropan-1-one;yttrium |
|---|---|
| PubChem CID | 176646453 |
| Molecular Formula | C13H21NO3Y-2 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-tert-butylpyrrolidin-1-ide-2,5-dione;2,2-dimethylpropan-1-one;yttrium |
| SMILES | CC(C)(C)C1CC(=O)[N-]C1=O.CC(C)(C)[C-]=O.[Y] |
| InChI | InChI=1S/C8H13NO2.C5H9O.Y/c1-8(2,3)5-4-6(10)9-7(5)11;1-5(2,3)4-6;/h5H,4H2,1-3H3,(H,9,10,11);1-3H3;/q;-1;/p-1 |
| InChIKey | IKNLGYCZMKRZFF-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|