C8H13NO2SY-2 — CID 59983896
3-methylsulfanylpyrrolidin-1-ide-2,5-dione;propane;yttrium (PubChem CID 59983896) has the molecular formula C8H13NO2SY-2 and a molecular weight of 276.17 g/mol. Its IUPAC name is 3-methylsulfanylpyrrolidin-1-ide-2,5-dione;propane;yttrium.
| Compound Name | 3-methylsulfanylpyrrolidin-1-ide-2,5-dione;propane;yttrium |
|---|---|
| PubChem CID | 59983896 |
| Molecular Formula | C8H13NO2SY-2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 3-methylsulfanylpyrrolidin-1-ide-2,5-dione;propane;yttrium |
| SMILES | CSC1CC(=O)[N-]C1=O.[CH2-]CC.[Y] |
| InChI | InChI=1S/C5H7NO2S.C3H7.Y/c1-9-3-2-4(7)6-5(3)8;1-3-2;/h3H,2H2,1H3,(H,6,7,8);1,3H2,2H3;/q;-1;/p-1 |
| InChIKey | ZIRMJLWOWANBMM-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|