C6H10N2O2SY-2 — CID 58203674
methylazanide;3-methylsulfanylpyrrolidin-1-ide-2,5-dione;yttrium (PubChem CID 58203674) has the molecular formula C6H10N2O2SY-2 and a molecular weight of 263.13 g/mol. Its IUPAC name is methylazanide;3-methylsulfanylpyrrolidin-1-ide-2,5-dione;yttrium.
| Compound Name | methylazanide;3-methylsulfanylpyrrolidin-1-ide-2,5-dione;yttrium |
|---|---|
| PubChem CID | 58203674 |
| Molecular Formula | C6H10N2O2SY-2 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | methylazanide;3-methylsulfanylpyrrolidin-1-ide-2,5-dione;yttrium |
| SMILES | CSC1CC(=O)[N-]C1=O.C[NH-].[Y] |
| InChI | InChI=1S/C5H7NO2S.CH4N.Y/c1-9-3-2-4(7)6-5(3)8;1-2;/h3H,2H2,1H3,(H,6,7,8);2H,1H3;/q;-1;/p-1 |
| InChIKey | UGFWKQVXEUICJR-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|