C6H10N2O2Y-2 — CID 58978220
imidazolidin-3-ide-2,4-dione;propane;yttrium (PubChem CID 58978220) has the molecular formula C6H10N2O2Y-2 and a molecular weight of 231.06 g/mol. Its IUPAC name is imidazolidin-3-ide-2,4-dione;propane;yttrium.
| Compound Name | imidazolidin-3-ide-2,4-dione;propane;yttrium |
|---|---|
| PubChem CID | 58978220 |
| Molecular Formula | C6H10N2O2Y-2 |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | imidazolidin-3-ide-2,4-dione;propane;yttrium |
| SMILES | O=C1CNC(=O)[N-]1.[CH2-]CC.[Y] |
| InChI | InChI=1S/C3H4N2O2.C3H7.Y/c6-2-1-4-3(7)5-2;1-3-2;/h1H2,(H2,4,5,6,7);1,3H2,2H3;/q;-1;/p-1 |
| InChIKey | GGGQQILDUBRPIL-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|