C36H40IrNO2S- — CID 176651572
(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;8-propan-2-yl-1-(6-propan-2-yl-2H-naphthalen-2-id-1-yl)-[1]benzothiolo[2,3-c]pyridine (PubChem CID 176651572) has the molecular formula C36H40IrNO2S- and a molecular weight of 743.01 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;8-propan-2-yl-1-(6-propan-2-yl-2H-naphthalen-2-id-1-yl)-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;8-propan-2-yl-1-(6-propan-2-yl-2H-naphthalen-2-id-1-yl)-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 176651572 |
| Molecular Formula | C36H40IrNO2S- |
| Molecular Weight | 743.01 g/mol |
| Exact Mass | 743.24 |
| IUPAC Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;8-propan-2-yl-1-(6-propan-2-yl-2H-naphthalen-2-id-1-yl)-[1]benzothiolo[2,3-c]pyridine |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C.CC(C)c1ccc2c(-c3nccc4c3sc3c(C(C)C)cccc34)[c-]ccc2c1.[Ir] |
| InChI | InChI=1S/C27H24NS.C9H16O2.Ir/c1-16(2)18-11-12-21-19(15-18)7-5-9-22(21)25-27-24(13-14-28-25)23-10-6-8-20(17(3)4)26(23)29-27;1-6(2)8(10)5-9(11)7(3)4;/h5-8,10-17H,1-4H3;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | CBQOCHHXPIHMNV-QBBOVCHSSA-N |
| XLogP | 10.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.01 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|