C19H15F4N3O — CID 176655406
N-[4-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)but-1-en-2-yl]phenyl]acetamide (PubChem CID 176655406) has the molecular formula C19H15F4N3O and a molecular weight of 377.34 g/mol. Its IUPAC name is N-[4-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)but-1-en-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)but-1-en-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 176655406 |
| Molecular Formula | C19H15F4N3O |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[4-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)but-1-en-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C(=C\c2ccc3n[nH]c(F)c3c2)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F4N3O/c1-11(27)24-15-5-3-13(4-6-15)14(10-19(21,22)23)8-12-2-7-17-16(9-12)18(20)26-25-17/h2-9H,10H2,1H3,(H,24,27)(H,25,26)/b14-8- |
| InChIKey | RWQPDPDRBAVECP-ZSOIEALJSA-N |
| XLogP | 5.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|