C19H28O6 — CID 176655808
1-[2-(2-methylprop-2-enoxymethyl)prop-2-enoyloxy]propyl 2-(2-methylprop-2-enoxymethyl)prop-2-enoate (PubChem CID 176655808) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[2-(2-methylprop-2-enoxymethyl)prop-2-enoyloxy]propyl 2-(2-methylprop-2-enoxymethyl)prop-2-enoate.
| Compound Name | 1-[2-(2-methylprop-2-enoxymethyl)prop-2-enoyloxy]propyl 2-(2-methylprop-2-enoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 176655808 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[2-(2-methylprop-2-enoxymethyl)prop-2-enoyloxy]propyl 2-(2-methylprop-2-enoxymethyl)prop-2-enoate |
| SMILES | C=C(C)COCC(=C)C(=O)OC(CC)OC(=O)C(=C)COCC(=C)C |
| InChI | InChI=1S/C19H28O6/c1-8-17(24-18(20)15(6)11-22-9-13(2)3)25-19(21)16(7)12-23-10-14(4)5/h17H,2,4,6-12H2,1,3,5H3 |
| InChIKey | YHLPSGXTXDNMIW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|