C19H29N2Y — CID 176657285
N-ethyl-N-(ethyliminomethyl)ethanamine;bis(5-methylcyclopenta-1,3-diene);yttrium(3+) (PubChem CID 176657285) has the molecular formula C19H29N2Y and a molecular weight of 374.36 g/mol. Its IUPAC name is N-ethyl-N-(ethyliminomethyl)ethanamine;bis(5-methylcyclopenta-1,3-diene);yttrium(3+).
| Compound Name | N-ethyl-N-(ethyliminomethyl)ethanamine;bis(5-methylcyclopenta-1,3-diene);yttrium(3+) |
|---|---|
| PubChem CID | 176657285 |
| Molecular Formula | C19H29N2Y |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-ethyl-N-(ethyliminomethyl)ethanamine;bis(5-methylcyclopenta-1,3-diene);yttrium(3+) |
| SMILES | CC/N=[C-]\N(CC)CC.C[c-]1cccc1.C[c-]1cccc1.[Y+3] |
| InChI | InChI=1S/C7H15N2.2C6H7.Y/c1-4-8-7-9(5-2)6-3;2*1-6-4-2-3-5-6;/h4-6H2,1-3H3;2*2-5H,1H3;/q3*-1;+3 |
| InChIKey | TWVGSJLASHYJDR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|