C24H34BClN2O5 — CID 176677003
tert-butyl (1S,6R,7R)-7-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]-8-oxa-10-azatricyclo[4.3.1.03,10]decane-3-carboxylate (PubChem CID 176677003) has the molecular formula C24H34BClN2O5 and a molecular weight of 476.81 g/mol. Its IUPAC name is tert-butyl (1S,6R,7R)-7-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]-8-oxa-10-azatricyclo[4.3.1.03,10]decane-3-carboxylate.
| Compound Name | tert-butyl (1S,6R,7R)-7-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]-8-oxa-10-azatricyclo[4.3.1.03,10]decane-3-carboxylate |
|---|---|
| PubChem CID | 176677003 |
| Molecular Formula | C24H34BClN2O5 |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | tert-butyl (1S,6R,7R)-7-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]-8-oxa-10-azatricyclo[4.3.1.03,10]decane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12CC[C@@H]3[C@@H](c4cc(Cl)nc(B5OC(C)(C)C(C)(C)O5)c4)OC[C@H](C1)N32 |
| InChI | InChI=1S/C24H34BClN2O5/c1-21(2,3)31-20(29)24-9-8-16-19(30-13-15(12-24)28(16)24)14-10-17(27-18(26)11-14)25-32-22(4,5)23(6,7)33-25/h10-11,15-16,19H,8-9,12-13H2,1-7H3/t15-,16+,19+,24?/m0/s1 |
| InChIKey | CKYBRWGMHNJDQR-KZCMZVOFSA-N |
| XLogP | 3.42 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|