C22H32BClIN3O5 — CID 176676869
tert-butyl (3R,5R)-4-acetyl-3-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]-5-iodopiperazine-1-carboxylate (PubChem CID 176676869) has the molecular formula C22H32BClIN3O5 and a molecular weight of 591.68 g/mol. Its IUPAC name is tert-butyl (3R,5R)-4-acetyl-3-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]-5-iodopiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R,5R)-4-acetyl-3-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]-5-iodopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176676869 |
| Molecular Formula | C22H32BClIN3O5 |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | tert-butyl (3R,5R)-4-acetyl-3-[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]-5-iodopiperazine-1-carboxylate |
| SMILES | CC(=O)N1[C@H](I)CN(C(=O)OC(C)(C)C)C[C@H]1c1cc(Cl)nc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H32BClIN3O5/c1-13(29)28-15(11-27(12-18(28)25)19(30)31-20(2,3)4)14-9-16(26-17(24)10-14)23-32-21(5,6)22(7,8)33-23/h9-10,15,18H,11-12H2,1-8H3/t15-,18-/m0/s1 |
| InChIKey | PCANODOTIJKAFL-YJBOKZPZSA-N |
| XLogP | 3.94 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|