C47H89NO5 — CID 176680681
2-hexyldec-9-enyl 6-[[6-[(E)-2-hexyldec-1-enoxy]-6-oxohexyl]-(3-hydroxypropyl)amino]hexanoate (PubChem CID 176680681) has the molecular formula C47H89NO5 and a molecular weight of 748.23 g/mol. Its IUPAC name is 2-hexyldec-9-enyl 6-[[6-[(E)-2-hexyldec-1-enoxy]-6-oxohexyl]-(3-hydroxypropyl)amino]hexanoate.
| Compound Name | 2-hexyldec-9-enyl 6-[[6-[(E)-2-hexyldec-1-enoxy]-6-oxohexyl]-(3-hydroxypropyl)amino]hexanoate |
|---|---|
| PubChem CID | 176680681 |
| Molecular Formula | C47H89NO5 |
| Molecular Weight | 748.23 g/mol |
| Exact Mass | 747.67 |
| IUPAC Name | 2-hexyldec-9-enyl 6-[[6-[(E)-2-hexyldec-1-enoxy]-6-oxohexyl]-(3-hydroxypropyl)amino]hexanoate |
| SMILES | C=CCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCCO)CCCCCC(=O)O/C=C(\CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C47H89NO5/c1-5-9-13-17-19-25-34-44(32-23-15-11-7-3)42-52-46(50)36-27-21-29-38-48(40-31-41-49)39-30-22-28-37-47(51)53-43-45(33-24-16-12-8-4)35-26-20-18-14-10-6-2/h5,43-44,49H,1,6-42H2,2-4H3/b45-43+ |
| InChIKey | JFAQQFRNFLYZDX-SKKHQMBASA-N |
| XLogP | 13.60 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.23 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|