C17H30N3O2P — CID 176680712
cyclobutane;4-[(2-ethenylpyrimidin-4-yl)-methylamino]cyclohexan-1-ol;phosphinous acid (PubChem CID 176680712) has the molecular formula C17H30N3O2P and a molecular weight of 339.42 g/mol. Its IUPAC name is cyclobutane;4-[(2-ethenylpyrimidin-4-yl)-methylamino]cyclohexan-1-ol;phosphinous acid.
| Compound Name | cyclobutane;4-[(2-ethenylpyrimidin-4-yl)-methylamino]cyclohexan-1-ol;phosphinous acid |
|---|---|
| PubChem CID | 176680712 |
| Molecular Formula | C17H30N3O2P |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | cyclobutane;4-[(2-ethenylpyrimidin-4-yl)-methylamino]cyclohexan-1-ol;phosphinous acid |
| SMILES | C1CCC1.C=Cc1nccc(N(C)C2CCC(O)CC2)n1.OP |
| InChI | InChI=1S/C13H19N3O.C4H8.H3OP/c1-3-12-14-9-8-13(15-12)16(2)10-4-6-11(17)7-5-10;1-2-4-3-1;1-2/h3,8-11,17H,1,4-7H2,2H3;1-4H2;1H,2H2 |
| InChIKey | BJCPEZXWIRSNLX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|