C13H20N3O2P — CID 176680740
[4-[(2-ethenylpyrimidin-4-yl)-methylamino]cyclohexyl]oxyphosphinous acid (PubChem CID 176680740) has the molecular formula C13H20N3O2P and a molecular weight of 281.30 g/mol. Its IUPAC name is [4-[(2-ethenylpyrimidin-4-yl)-methylamino]cyclohexyl]oxyphosphinous acid.
| Compound Name | [4-[(2-ethenylpyrimidin-4-yl)-methylamino]cyclohexyl]oxyphosphinous acid |
|---|---|
| PubChem CID | 176680740 |
| Molecular Formula | C13H20N3O2P |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [4-[(2-ethenylpyrimidin-4-yl)-methylamino]cyclohexyl]oxyphosphinous acid |
| SMILES | C=Cc1nccc(N(C)C2CCC(OPO)CC2)n1 |
| InChI | InChI=1S/C13H20N3O2P/c1-3-12-14-9-8-13(15-12)16(2)10-4-6-11(7-5-10)18-19-17/h3,8-11,17,19H,1,4-7H2,2H3 |
| InChIKey | NKELCRWCAHSVHL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|