C16H30N3O2PS — CID 176680897
[4-[methyl-[2-(2-sulfanylethyl)pyrimidin-4-yl]amino]cyclohexyl]oxyphosphinous acid;propane (PubChem CID 176680897) has the molecular formula C16H30N3O2PS and a molecular weight of 359.48 g/mol. Its IUPAC name is [4-[methyl-[2-(2-sulfanylethyl)pyrimidin-4-yl]amino]cyclohexyl]oxyphosphinous acid;propane.
| Compound Name | [4-[methyl-[2-(2-sulfanylethyl)pyrimidin-4-yl]amino]cyclohexyl]oxyphosphinous acid;propane |
|---|---|
| PubChem CID | 176680897 |
| Molecular Formula | C16H30N3O2PS |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | [4-[methyl-[2-(2-sulfanylethyl)pyrimidin-4-yl]amino]cyclohexyl]oxyphosphinous acid;propane |
| SMILES | CCC.CN(c1ccnc(CCS)n1)C1CCC(OPO)CC1 |
| InChI | InChI=1S/C13H22N3O2PS.C3H8/c1-16(10-2-4-11(5-3-10)18-19-17)13-6-8-14-12(15-13)7-9-20;1-3-2/h6,8,10-11,17,19-20H,2-5,7,9H2,1H3;3H2,1-2H3 |
| InChIKey | IEQJKHIVFMNQCQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|