C17H29N5O2PS- — CID 176680875
S-[2-[4-[[4-[cyclobutyl(oxido)phosphinimyl]oxycyclohexyl]-methylamino]pyrimidin-2-yl]ethyl]thiohydroxylamine (PubChem CID 176680875) has the molecular formula C17H29N5O2PS- and a molecular weight of 398.49 g/mol. Its IUPAC name is S-[2-[4-[[4-[cyclobutyl(oxido)phosphinimyl]oxycyclohexyl]-methylamino]pyrimidin-2-yl]ethyl]thiohydroxylamine.
| Compound Name | S-[2-[4-[[4-[cyclobutyl(oxido)phosphinimyl]oxycyclohexyl]-methylamino]pyrimidin-2-yl]ethyl]thiohydroxylamine |
|---|---|
| PubChem CID | 176680875 |
| Molecular Formula | C17H29N5O2PS- |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | S-[2-[4-[[4-[cyclobutyl(oxido)phosphinimyl]oxycyclohexyl]-methylamino]pyrimidin-2-yl]ethyl]thiohydroxylamine |
| SMILES | [H]N=P([O-])(OC1CCC(N(C)c2ccnc(CCSN)n2)CC1)C1CCC1 |
| InChI | InChI=1S/C17H29N5O2PS/c1-22(17-9-11-20-16(21-17)10-12-26-19)13-5-7-14(8-6-13)24-25(18,23)15-3-2-4-15/h9,11,13-15H,2-8,10,12,19H2,1H3,(H-,18,23)/q-1 |
| InChIKey | VXYUTHQGFZTUOM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|