C22H22N2O5 — CID 176691381
[2-(tert-butylamino)-1-(4-methoxycarbonylphenyl)-2-oxoethyl] 4-cyanobenzoate (PubChem CID 176691381) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-(tert-butylamino)-1-(4-methoxycarbonylphenyl)-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-(tert-butylamino)-1-(4-methoxycarbonylphenyl)-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 176691381 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-(tert-butylamino)-1-(4-methoxycarbonylphenyl)-2-oxoethyl] 4-cyanobenzoate |
| SMILES | COC(=O)c1ccc(C(OC(=O)c2ccc(C#N)cc2)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-22(2,3)24-19(25)18(15-9-11-16(12-10-15)20(26)28-4)29-21(27)17-7-5-14(13-23)6-8-17/h5-12,18H,1-4H3,(H,24,25) |
| InChIKey | QEBMEWNMGGJCST-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |