C14H16Br2N2O — CID 7039397
(2S,3R)-2,3-dibromo-N-tert-butyl-3-(4-cyanophenyl)propanamide (PubChem CID 7039397) has the molecular formula C14H16Br2N2O and a molecular weight of 388.10 g/mol. Its IUPAC name is (2S,3R)-2,3-dibromo-N-tert-butyl-3-(4-cyanophenyl)propanamide.
| Compound Name | (2S,3R)-2,3-dibromo-N-tert-butyl-3-(4-cyanophenyl)propanamide |
|---|---|
| PubChem CID | 7039397 |
| Molecular Formula | C14H16Br2N2O |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | (2S,3R)-2,3-dibromo-N-tert-butyl-3-(4-cyanophenyl)propanamide |
| SMILES | CC(C)(C)NC(=O)[C@H](Br)[C@H](Br)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H16Br2N2O/c1-14(2,3)18-13(19)12(16)11(15)10-6-4-9(8-17)5-7-10/h4-7,11-12H,1-3H3,(H,18,19)/t11-,12-/m1/s1 |
| InChIKey | DMJZOKRFIGZXSJ-VXGBXAGGSA-N |
| XLogP | 3.67 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|