C28H39N2O5- — CID 176697191
(1R,2R)-2-[(5aS,6R,9R)-3,6-dimethyl-1,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[c]oxepin-9-yl]-1-[4-[[(3S)-6-methylidene-2-oxopiperidin-3-yl]carbamoyl]phenoxy]propan-1-olate (PubChem CID 176697191) has the molecular formula C28H39N2O5- and a molecular weight of 483.63 g/mol. Its IUPAC name is (1R,2R)-2-[(5aS,6R,9R)-3,6-dimethyl-1,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[c]oxepin-9-yl]-1-[4-[[(3S)-6-methylidene-2-oxopiperidin-3-yl]carbamoyl]phenoxy]propan-1-olate.
| Compound Name | (1R,2R)-2-[(5aS,6R,9R)-3,6-dimethyl-1,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[c]oxepin-9-yl]-1-[4-[[(3S)-6-methylidene-2-oxopiperidin-3-yl]carbamoyl]phenoxy]propan-1-olate |
|---|---|
| PubChem CID | 176697191 |
| Molecular Formula | C28H39N2O5- |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | (1R,2R)-2-[(5aS,6R,9R)-3,6-dimethyl-1,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[c]oxepin-9-yl]-1-[4-[[(3S)-6-methylidene-2-oxopiperidin-3-yl]carbamoyl]phenoxy]propan-1-olate |
| SMILES | C=C1CC[C@H](NC(=O)c2ccc(O[C@@H]([O-])[C@H](C)[C@@H]3CC[C@@H](C)[C@@H]4CCC(C)OCC34)cc2)C(=O)N1 |
| InChI | InChI=1S/C28H39N2O5/c1-16-5-12-23(24-15-34-18(3)7-13-22(16)24)19(4)28(33)35-21-10-8-20(9-11-21)26(31)30-25-14-6-17(2)29-27(25)32/h8-11,16,18-19,22-25,28H,2,5-7,12-15H2,1,3-4H3,(H,29,32)(H,30,31)/q-1/t16-,18?,19-,22+,23+,24?,25+,28-/m1/s1 |
| InChIKey | VYZZTPNMKYSTOV-SIUSAGEFSA-N |
| XLogP | 3.39 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|