C21H29N3O2 — CID 176699799
benzyl carbamate;cyclopentane;1,2,3,4-tetrahydro-1,5-naphthyridine (PubChem CID 176699799) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is benzyl carbamate;cyclopentane;1,2,3,4-tetrahydro-1,5-naphthyridine.
| Compound Name | benzyl carbamate;cyclopentane;1,2,3,4-tetrahydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 176699799 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | benzyl carbamate;cyclopentane;1,2,3,4-tetrahydro-1,5-naphthyridine |
| SMILES | C1CCCC1.NC(=O)OCc1ccccc1.c1cnc2c(c1)NCCC2 |
| InChI | InChI=1S/C8H10N2.C8H9NO2.C5H10/c1-3-7-8(9-5-1)4-2-6-10-7;9-8(10)11-6-7-4-2-1-3-5-7;1-2-4-5-3-1/h1,3,5,10H,2,4,6H2;1-5H,6H2,(H2,9,10);1-5H2 |
| InChIKey | HATQMPLJGFIYDA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |