About 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene
3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene (PubChem CID 176703845) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene.
Analyze 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene?
The IUPAC name of 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene (CID 176703845) is 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene.
What is the SMILES notation for 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene?
The canonical SMILES for 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene is CCC1=CCCC2=C1CCC2(CC)C(C)C.
What is the InChIKey of 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene?
The InChIKey is ROLRCLBWBGXVMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26/c1-5-13-8-7-9-15-14(13)10-11-16(15,6-2)12(3)4/h8,12H,5-7,9-11H2,1-4H3.
What are the key properties of 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene?
3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene has a molecular weight of 218.38 g/mol, XLogP of 5.26, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-diethyl-3-propan-2-yl-1,2,4,5-tetrahydroindene is sourced from PubChem (CID 176703845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).