C11H17F2NS — CID 176707119
(2E,4E,6Z)-4-(difluoromethylsulfanyl)-N-ethylocta-2,4,6-trien-3-amine (PubChem CID 176707119) has the molecular formula C11H17F2NS and a molecular weight of 233.33 g/mol. Its IUPAC name is (2E,4E,6Z)-4-(difluoromethylsulfanyl)-N-ethylocta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E,6Z)-4-(difluoromethylsulfanyl)-N-ethylocta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176707119 |
| Molecular Formula | C11H17F2NS |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | (2E,4E,6Z)-4-(difluoromethylsulfanyl)-N-ethylocta-2,4,6-trien-3-amine |
| SMILES | C/C=C\C=C(SC(F)F)/C(=C\C)NCC |
| InChI | InChI=1S/C11H17F2NS/c1-4-7-8-10(15-11(12)13)9(5-2)14-6-3/h4-5,7-8,11,14H,6H2,1-3H3/b7-4-,9-5+,10-8+ |
| InChIKey | HVJGULVDXRYHNX-NDAORYFVSA-N |
| XLogP | 3.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|