About 1-(ethenoxymethyl)-3,5-difluorobenzene
1-(ethenoxymethyl)-3,5-difluorobenzene (PubChem CID 176708559) has the molecular formula C9H8F2O
and a molecular weight of 170.16 g/mol. Its IUPAC name is 1-(ethenoxymethyl)-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-(ethenoxymethyl)-3,5-difluorobenzene |
| PubChem CID | 176708559 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 1-(ethenoxymethyl)-3,5-difluorobenzene |
| SMILES | C=COCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H8F2O/c1-2-12-6-7-3-8(10)5-9(11)4-7/h2-5H,1,6H2 |
| InChIKey | WTDBZLOOMAFPAA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethenoxymethyl)-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethenoxymethyl)-3,5-difluorobenzene?
The IUPAC name of 1-(ethenoxymethyl)-3,5-difluorobenzene (CID 176708559) is 1-(ethenoxymethyl)-3,5-difluorobenzene.
What is the SMILES notation for 1-(ethenoxymethyl)-3,5-difluorobenzene?
The canonical SMILES for 1-(ethenoxymethyl)-3,5-difluorobenzene is C=COCc1cc(F)cc(F)c1.
What is the InChIKey of 1-(ethenoxymethyl)-3,5-difluorobenzene?
The InChIKey is WTDBZLOOMAFPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O/c1-2-12-6-7-3-8(10)5-9(11)4-7/h2-5H,1,6H2.
What are the key properties of 1-(ethenoxymethyl)-3,5-difluorobenzene?
1-(ethenoxymethyl)-3,5-difluorobenzene has a molecular weight of 170.16 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethenoxymethyl)-3,5-difluorobenzene is sourced from PubChem (CID 176708559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).