C55H92N2O12 — CID 176710466
7-O-[2-[[7-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-7-oxoheptanoyl]oxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxy]propyl] 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] heptanedioate (PubChem CID 176710466) has the molecular formula C55H92N2O12 and a molecular weight of 973.34 g/mol. Its IUPAC name is 7-O-[2-[[7-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-7-oxoheptanoyl]oxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxy]propyl] 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] heptanedioate.
| Compound Name | 7-O-[2-[[7-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-7-oxoheptanoyl]oxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxy]propyl] 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] heptanedioate |
|---|---|
| PubChem CID | 176710466 |
| Molecular Formula | C55H92N2O12 |
| Molecular Weight | 973.34 g/mol |
| Exact Mass | 972.67 |
| IUPAC Name | 7-O-[2-[[7-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-7-oxoheptanoyl]oxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxy]propyl] 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] heptanedioate |
| SMILES | CCCCCCC(CCC(=O)OCC(COC(=O)CCCCCC(=O)OC/C=C(/C)CCC=C(C)C)COC(=O)CCCCCC(=O)OC/C=C(/C)CCC=C(C)C)OC(=O)NCCN1CCCC1 |
| InChI | InChI=1S/C55H92N2O12/c1-8-9-10-13-26-49(69-55(63)56-35-38-57-36-18-19-37-57)31-32-54(62)68-43-48(41-66-52(60)29-16-11-14-27-50(58)64-39-33-46(6)24-20-22-44(2)3)42-67-53(61)30-17-12-15-28-51(59)65-40-34-47(7)25-21-23-45(4)5/h22-23,33-34,48-49H,8-21,24-32,35-43H2,1-7H3,(H,56,63)/b46-33-,47-34- |
| InChIKey | SXPHXXPLZNNBTI-ATDPFJBRSA-N |
| XLogP | 11.55 |
| TPSA | 173.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.34 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|