C21H29N3O2S — CID 176713512
ethane;3-[7-(1-methylpiperidin-4-yl)-3-sulfanylidene-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 176713512) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is ethane;3-[7-(1-methylpiperidin-4-yl)-3-sulfanylidene-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[7-(1-methylpiperidin-4-yl)-3-sulfanylidene-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176713512 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | ethane;3-[7-(1-methylpiperidin-4-yl)-3-sulfanylidene-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC.CN1CCC(c2cccc3c2CN(C2CCC(=O)NC2=O)C3=S)CC1 |
| InChI | InChI=1S/C19H23N3O2S.C2H6/c1-21-9-7-12(8-10-21)13-3-2-4-14-15(13)11-22(19(14)25)16-5-6-17(23)20-18(16)24;1-2/h2-4,12,16H,5-11H2,1H3,(H,20,23,24);1-2H3 |
| InChIKey | RJVLPVIPSMWXNI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|