C11H31ClO3Si5 — CID 176715119
CID 176715119 (PubChem CID 176715119) has the molecular formula C11H31ClO3Si5 and a molecular weight of 387.25 g/mol.
| Compound Name | CID 176715119 |
|---|---|
| PubChem CID | 176715119 |
| Molecular Formula | C11H31ClO3Si5 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)O[Si](CC[Si]Cl)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H31ClO3Si5/c1-17(2,3)13-20(11-10-16-12,14-18(4,5)6)15-19(7,8)9/h10-11H2,1-9H3 |
| InChIKey | JNKDDLGLKDVURD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|