C23H25ClFN5O5 — CID 176717907
3-[7-chloro-5-[[(1-cyclobutylpyrazol-3-yl)methylamino]methyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;formic acid (PubChem CID 176717907) has the molecular formula C23H25ClFN5O5 and a molecular weight of 505.93 g/mol. Its IUPAC name is 3-[7-chloro-5-[[(1-cyclobutylpyrazol-3-yl)methylamino]methyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;formic acid.
| Compound Name | 3-[7-chloro-5-[[(1-cyclobutylpyrazol-3-yl)methylamino]methyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;formic acid |
|---|---|
| PubChem CID | 176717907 |
| Molecular Formula | C23H25ClFN5O5 |
| Molecular Weight | 505.93 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 3-[7-chloro-5-[[(1-cyclobutylpyrazol-3-yl)methylamino]methyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;formic acid |
| SMILES | O=C1CCC(N2Cc3c(Cl)cc(CNCc4ccn(C5CCC5)n4)c(F)c3C2=O)C(=O)N1.O=CO |
| InChI | InChI=1S/C22H23ClFN5O3.CH2O2/c23-16-8-12(9-25-10-13-6-7-29(27-13)14-2-1-3-14)20(24)19-15(16)11-28(22(19)32)17-4-5-18(30)26-21(17)31;2-1-3/h6-8,14,17,25H,1-5,9-11H2,(H,26,30,31);1H,(H,2,3) |
| InChIKey | ZRTFIYUSKMZNDH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|