C25H27N4O4P — CID 176732650
2-[1-[3-cyano-8-methoxy-2-[(E)-2-pyridin-3-ylethenyl]quinolin-4-yl]piperidin-4-yl]ethylphosphonic acid (PubChem CID 176732650) has the molecular formula C25H27N4O4P and a molecular weight of 478.49 g/mol. Its IUPAC name is 2-[1-[3-cyano-8-methoxy-2-[(E)-2-pyridin-3-ylethenyl]quinolin-4-yl]piperidin-4-yl]ethylphosphonic acid.
| Compound Name | 2-[1-[3-cyano-8-methoxy-2-[(E)-2-pyridin-3-ylethenyl]quinolin-4-yl]piperidin-4-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 176732650 |
| Molecular Formula | C25H27N4O4P |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-[1-[3-cyano-8-methoxy-2-[(E)-2-pyridin-3-ylethenyl]quinolin-4-yl]piperidin-4-yl]ethylphosphonic acid |
| SMILES | COc1cccc2c(N3CCC(CCP(=O)(O)O)CC3)c(C#N)c(/C=C/c3cccnc3)nc12 |
| InChI | InChI=1S/C25H27N4O4P/c1-33-23-6-2-5-20-24(23)28-22(8-7-19-4-3-12-27-17-19)21(16-26)25(20)29-13-9-18(10-14-29)11-15-34(30,31)32/h2-8,12,17-18H,9-11,13-15H2,1H3,(H2,30,31,32)/b8-7+ |
| InChIKey | AYAFWENHYOLDOT-BQYQJAHWSA-N |
| XLogP | 4.46 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|