C14H31N — CID 176737681
N-tert-butyl-N,2,5,5-tetramethylhexan-2-amine (PubChem CID 176737681) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is N-tert-butyl-N,2,5,5-tetramethylhexan-2-amine.
| Compound Name | N-tert-butyl-N,2,5,5-tetramethylhexan-2-amine |
|---|---|
| PubChem CID | 176737681 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | N-tert-butyl-N,2,5,5-tetramethylhexan-2-amine |
| SMILES | CN(C(C)(C)C)C(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C14H31N/c1-12(2,3)10-11-14(7,8)15(9)13(4,5)6/h10-11H2,1-9H3 |
| InChIKey | AGDYSRBNSYBBSU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |