C34H68N2O4 — CID 123575246
bis[4-[tert-butyl(methyl)amino]-4-methylpentan-2-yl] 2,5-diethyl-2,5-dimethylhexanedioate (PubChem CID 123575246) has the molecular formula C34H68N2O4 and a molecular weight of 568.93 g/mol. Its IUPAC name is bis[4-[tert-butyl(methyl)amino]-4-methylpentan-2-yl] 2,5-diethyl-2,5-dimethylhexanedioate.
| Compound Name | bis[4-[tert-butyl(methyl)amino]-4-methylpentan-2-yl] 2,5-diethyl-2,5-dimethylhexanedioate |
|---|---|
| PubChem CID | 123575246 |
| Molecular Formula | C34H68N2O4 |
| Molecular Weight | 568.93 g/mol |
| Exact Mass | 568.52 |
| IUPAC Name | bis[4-[tert-butyl(methyl)amino]-4-methylpentan-2-yl] 2,5-diethyl-2,5-dimethylhexanedioate |
| SMILES | CCC(C)(CCC(C)(CC)C(=O)OC(C)CC(C)(C)N(C)C(C)(C)C)C(=O)OC(C)CC(C)(C)N(C)C(C)(C)C |
| InChI | InChI=1S/C34H68N2O4/c1-19-33(15,27(37)39-25(3)23-31(11,12)35(17)29(5,6)7)21-22-34(16,20-2)28(38)40-26(4)24-32(13,14)36(18)30(8,9)10/h25-26H,19-24H2,1-18H3 |
| InChIKey | SGOMBFOTGNBMNT-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.93 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |