C26H27N7O2 — CID 176754425
7-formyl-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]-3,3-dimethyl-1,2-dihydropyrrolo[3,2-b]pyridine-5-carboxamide (PubChem CID 176754425) has the molecular formula C26H27N7O2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 7-formyl-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]-3,3-dimethyl-1,2-dihydropyrrolo[3,2-b]pyridine-5-carboxamide.
| Compound Name | 7-formyl-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]-3,3-dimethyl-1,2-dihydropyrrolo[3,2-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 176754425 |
| Molecular Formula | C26H27N7O2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 7-formyl-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]-3,3-dimethyl-1,2-dihydropyrrolo[3,2-b]pyridine-5-carboxamide |
| SMILES | [C-]#[N+]C1CC(Cc2nncn2C)(c2cccc(NC(=O)c3cc(C=O)c4c(n3)C(C)(C)CN4)c2)C1 |
| InChI | InChI=1S/C26H27N7O2/c1-25(2)14-28-22-16(13-34)8-20(31-23(22)25)24(35)30-18-7-5-6-17(9-18)26(10-19(11-26)27-3)12-21-32-29-15-33(21)4/h5-9,13,15,19,28H,10-12,14H2,1-2,4H3,(H,30,35) |
| InChIKey | ZWZXIJGGWLTXNH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|