C15H17N5 — CID 176754406
3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]aniline (PubChem CID 176754406) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]aniline.
| Compound Name | 3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]aniline |
|---|---|
| PubChem CID | 176754406 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]aniline |
| SMILES | [C-]#[N+]C1CC(Cc2nncn2C)(c2cccc(N)c2)C1 |
| InChI | InChI=1S/C15H17N5/c1-17-13-7-15(8-13,9-14-19-18-10-20(14)2)11-4-3-5-12(16)6-11/h3-6,10,13H,7-9,16H2,2H3 |
| InChIKey | YWBPMRNYEBOSES-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|