C24H20ClN7O2 — CID 176754385
3-chloro-6-formyl-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]imidazo[1,2-a]pyridine-8-carboxamide (PubChem CID 176754385) has the molecular formula C24H20ClN7O2 and a molecular weight of 473.92 g/mol. Its IUPAC name is 3-chloro-6-formyl-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]imidazo[1,2-a]pyridine-8-carboxamide.
| Compound Name | 3-chloro-6-formyl-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]imidazo[1,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 176754385 |
| Molecular Formula | C24H20ClN7O2 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 3-chloro-6-formyl-N-[3-[3-isocyano-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutyl]phenyl]imidazo[1,2-a]pyridine-8-carboxamide |
| SMILES | [C-]#[N+]C1CC(Cc2nncn2C)(c2cccc(NC(=O)c3cc(C=O)cn4c(Cl)cnc34)c2)C1 |
| InChI | InChI=1S/C24H20ClN7O2/c1-26-18-8-24(9-18,10-21-30-28-14-31(21)2)16-4-3-5-17(7-16)29-23(34)19-6-15(13-33)12-32-20(25)11-27-22(19)32/h3-7,11-14,18H,8-10H2,2H3,(H,29,34) |
| InChIKey | HFPKHXJBRRVKBW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|